Introduction：Basic information about CAS 6277-67-4|1-Butanone,4-nitro-1,3-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Butanone,4-nitro-1,3-diphenyl- |
|---|
| CAS Number | 6277-67-4 | Molecular Weight | 269.29500 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 452.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.1ºC |
|---|
Names
| Name | 4-nitro-1,3-diphenylbutan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 452.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO3 |
|---|
| Molecular Weight | 269.29500 |
|---|
| Flash Point | 215.1ºC |
|---|
| Exact Mass | 269.10500 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 3.84310 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | HSDQDDXGMUPFTK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(C[N+](=O)[O-])c1ccccc1)c1ccccc1 |
|---|
Synonyms
| 4-Nitro-1,3-diphenyl-butan-1-on |
| 1,3-diphenyl-4-nitro-1-butanone |
| 1-Butanone,4-nitro-1,3-diphenyl |
| 4-nitro-1,3-diphenyl-1-butanone |
| 4-Nitro-1,3-diphenyl-butan-1-one |
