Introduction:Basic information about CAS 37002-45-2|(-)-1,4-di-o-tosyl-2,3-o-isopropylidenethreitol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (-)-1,4-di-o-tosyl-2,3-o-isopropylidenethreitol |
|---|
| CAS Number | 37002-45-2 | Molecular Weight | 470.556 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 608.3±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H26O8S2 | Melting Point | 90-92ºC(lit.) |
|---|
| MSDS | / | Flash Point | 321.7±27.3 °C |
|---|
Names
| Name | (4S,5S)-(-)-4,5-Bis(tosyloxymethyl)-2,2-dimethyl-1,3-dioxolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 608.3±40.0 °C at 760 mmHg |
|---|
| Melting Point | 90-92ºC(lit.) |
|---|
| Molecular Formula | C21H26O8S2 |
|---|
| Molecular Weight | 470.556 |
|---|
| Flash Point | 321.7±27.3 °C |
|---|
| Exact Mass | 470.106903 |
|---|
| PSA | 121.96000 |
|---|
| LogP | 3.03 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | KPFDKWNWYAXRNJ-PMACEKPBSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC(C)(C)OC2COS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Safety Phrases | 24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| (4S,5S)-(-)-2,3-O-Isopropylidene-1,4-di-O-tosyl-L-threitol |
| (4S,5S)-(-)-2,2-Dimethyl-4,5-bis(tosyloxymethyl)-1,3-dioxide |
| (−)-2,3-O-Isopropylidene-1,4-di-O-tosyl-L-threitol |
| (-)-1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol |
| (−)-2,3-O-Isopropylidene-L-threitol 1,4-ditosylate |
| EINECS 253-306-3 |
| (s,s)-(-)-1,4-Di-O-tosyl-2,3-O-isopropy Lidene-L-threitol |
| 1,3-Dioxolane-4,5-dimethanol, 2,2-dimethyl-, bis(4-methylbenzenesulfonate), (4S,5S)- |
| (4S,5S)-4,5-Bis(tosyloxymethyl)-2,2-dimethyl-1,3-dioxolane |
| [(4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl]bis(methylene) bis(4-methylbenzenesulfonate) |
| (−)-1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol |
| MFCD00003212 |
| (S,S)-(-)-1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol |
| [2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |