Introduction:Basic information about CAS 102153-63-9|6-Chlornaphthalen-2-sulfonylchlorid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chlornaphthalen-2-sulfonylchlorid |
|---|
| CAS Number | 102153-63-9 | Molecular Weight | 261.124 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 402.9±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6Cl2O2S | Melting Point | 108 °C |
|---|
| MSDS | / | Flash Point | 197.5±21.8 °C |
|---|
Names
| Name | 6-Chloro-2-naphthylsulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 402.9±20.0 °C at 760 mmHg |
|---|
| Melting Point | 108 °C |
|---|
| Molecular Formula | C10H6Cl2O2S |
|---|
| Molecular Weight | 261.124 |
|---|
| Flash Point | 197.5±21.8 °C |
|---|
| Exact Mass | 259.946564 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.81 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.650 |
|---|
| InChIKey | IYFIYGSJZIICOZ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc2cc(Cl)ccc2c1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 6-Chloro-2-naphthyls |
| 6-Chloronaphthalene sulfonyl chloide |
| 6-Chloro-naphthalene-2-sulfonyl chloride |
| 6-chloronaphth-2-ylsulphonyl chloride |
| 6-Chloro-2-naphthalenesulfonyl chloride |
| 2-Naphthalenesulfonyl chloride, 6-chloro- |
| 6-Cloro-2-Naphthylsulfonyl Chlorid |
| 6-cloro-2-naphthylsulfonylchloride |
| 6-Chloro-2-Naphthylsulfonyl Chloride |
| 6-chloro-2-naphthylsulfonylchloride |
| 6-Chlornaphthalen-2-sulfonylchlorid |
| 6-chloronaphtalene-2-sulfonyl chloride |
| 6-CHLORO-2-NAPHTHYLSULFONYL CHLORIDE MIN |
| 6-chloronaphthalen-2-ylsulfonyl chloride |
| MFCD04037080 |
| 2-Chloro-6-naphthalenesulfonyl chloride |
| 6-Chloronaphthalene-2-sulfonyl chloride |