Introduction：Basic information about CAS 6961-57-5|3-[2-nitro-4-(trifluoromethyl)phenoxy]benzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[2-nitro-4-(trifluoromethyl)phenoxy]benzaldehyde |
|---|
| CAS Number | 6961-57-5 | Molecular Weight | 311.21300 |
|---|
| Density | 1.433g/cm3 | Boiling Point | 384.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.5ºC |
|---|
Names
| Name | 3-[2-nitro-4-(trifluoromethyl)phenoxy]benzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.433g/cm3 |
|---|
| Boiling Point | 384.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8F3NO4 |
|---|
| Molecular Weight | 311.21300 |
|---|
| Flash Point | 186.5ºC |
|---|
| Exact Mass | 311.04100 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 4.74160 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | ATRVIOQTDTZEET-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
|---|
