Introduction：Basic information about CAS 29559-24-8|Benzene,1-chloro-4-(nitromethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1-chloro-4-(nitromethyl)- |
|---|
| CAS Number | 29559-24-8 | Molecular Weight | 171.58100 |
|---|
| Density | 1.315g/cm3 | Boiling Point | 263.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H6ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113.2ºC |
|---|
Names
| Name | 1-chloro-4-(nitromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.315g/cm3 |
|---|
| Boiling Point | 263.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H6ClNO2 |
|---|
| Molecular Weight | 171.58100 |
|---|
| Flash Point | 113.2ºC |
|---|
| Exact Mass | 171.00900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.63990 |
|---|
| Vapour Pressure | 0.0102mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | KNOZMCIHCIMLDY-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])Cc1ccc(Cl)cc1 |
|---|
Synonyms
| 1-chloro-4-nitromethyl-benzene |
| 1-Chlor-4-nitromethyl-benzol |
| p-chlorophenyl nitromethane |
