Introduction:Basic information about CAS 102507-13-1|(2S)-2-(N-tert-Butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2S)-2-(N-tert-Butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid |
|---|
| CAS Number | 102507-13-1 | Molecular Weight | 233.262 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 391.1±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H19NO5 | Melting Point | 116-118℃ |
|---|
| MSDS | / | Flash Point | 190.3±26.5 °C |
|---|
Names
| Name | (2S)-3-hydroxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 391.1±37.0 °C at 760 mmHg |
|---|
| Melting Point | 116-118℃ |
|---|
| Molecular Formula | C10H19NO5 |
|---|
| Molecular Weight | 233.262 |
|---|
| Flash Point | 190.3±26.5 °C |
|---|
| Exact Mass | 233.126328 |
|---|
| PSA | 95.86000 |
|---|
| LogP | 0.91 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.483 |
|---|
| InChIKey | SZVRVSZFEDIMFM-ZCFIWIBFSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-boc-3-hydroxy-L-valine |
| boc-l-ser(3,3-dimethyl) |
| N-[(1,1-Dimethylethoxy)Carbonyl]-3-Methyl-L-Threonine |
| (S)-N-Boc-2-Amino-3-hydroxy-3-methylbutanoic acid |
| (2S)-2-(N-tert-Butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid |
| (2S)-2-(N-t-butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid |
| (S)-2-Boc-amino-3-hydroxy-3-methylbutyric acid |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-hydroxy-3-methylbutanoic acid |
| 3-Hydroxy-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-valine |
| n-boc-(s)-2-amino-3-hydroxy-3-methylbutanoic acid |
| N-(tert-Butoxycarbonyl)-3-hydroxy-L-valine |
| L-Threonine,N-[(1,1-dimethylethoxy)carbonyl]-3-methyl |
| (S)-2-N-Boc-amino-3-hydroxy-3-methylbutyric acid |
| L-Threonine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- |