Introduction:Basic information about CAS 243972-26-1|2-(N-BOC)-5-(tributylstannyl)thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(N-BOC)-5-(tributylstannyl)thiazole |
|---|
| CAS Number | 243972-26-1 | Molecular Weight | 489.303 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H38N2O2SSn | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS06, GHS08, GHS09 | Signal Word | Danger |
|---|
Names
| Name | tert-butyl N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H38N2O2SSn |
|---|
| Molecular Weight | 489.303 |
|---|
| Exact Mass | 490.167603 |
|---|
| PSA | 79.46000 |
|---|
| LogP | 9.67 |
|---|
| InChIKey | WBQYLGCBVADFPD-UHFFFAOYSA-N |
|---|
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(NC(=O)OC(C)(C)C)s1 |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
| Symbol | GHS06, GHS08, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
|---|
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
|---|
| RIDADR | UN 3146 6.1 / PGIII |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| Carbamic acid, N-[5-(tributylstannyl)-2-thiazolyl]-, 1,1-dimethylethyl ester |
| tert-Butyl [5-(tributylstannyl)-1,3-thiazol-2-yl]carbamate |
| (5-tributylstannyl-thiazol-2-yl)-carbamic acid tert-butyl ester |
| tert-butyl 5-(tributylstannyl)thiazol-2-ylcarbamate |
| 2-(N-BOC)-5-(tributylstannyl)thiazole |
| 2-Amino-5-(tributylstannyl)-1,3-thiazole, 2-BOC protected |
| 2-Methyl-2-propanyl [5-(tributylstannyl)-1,3-thiazol-2-yl]carbamate |
| tert-Butyl-5-(tributylstannyl)thiazol-2-ylcarbamate |
| (N-Boc-2-aminothiazolo)tributyltin |