Introduction：Basic information about CAS 54276-22-1|(+)-15-epi Cloprostenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (+)-15-epi Cloprostenol |
|---|
| CAS Number | 54276-22-1 | Molecular Weight | 424.915 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 628.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H29ClO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 333.6±31.5 °C |
|---|
Names
| Name | (+)-15-epi Cloprostenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 628.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H29ClO6 |
|---|
| Molecular Weight | 424.915 |
|---|
| Flash Point | 333.6±31.5 °C |
|---|
| Exact Mass | 424.165253 |
|---|
| PSA | 107.22000 |
|---|
| LogP | 2.31 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | VJGGHXVGBSZVMZ-HBWANGNJSA-N |
|---|
| SMILES | O=C(O)CCCC=CCC1C(O)CC(O)C1C=CC(O)COc1cccc(Cl)c1 |
|---|
Synonyms
| 5-Heptenoic acid, 7-[(2R)-2-[(1E,3S)-4-(3-chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-, (5Z)- |
| (5Z)-7-{(1R,2R,3R,5S)-2-[(1E,3S)-4-(3-Chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-5-heptenoic acid |
| (5Z)-7-{(2R)-2-[(1E,3S)-4-(3-Chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-5-heptenoic acid |
| D-Cloprostenol |
| 5-Heptenoic acid, 7-[(1R,2R,3R,5S)-2-[(1E,3S)-4-(3-chlorophenoxy)-3-hydroxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-, (5Z)- |
