Introduction：Basic information about CAS 69254-37-1|Arachidonic acid-d8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Arachidonic acid-d8 |
|---|
| CAS Number | 69254-37-1 | Molecular Weight | 312.52 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 407.5±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H24D8O2 | Melting Point | -49 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 336.3±18.0 °C |
|---|
Names
| Name | 5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoic acid |
|---|
| Synonym | More Synonyms |
|---|
Arachidonic acid-d8 BiologicalActivity
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 407.5±0.0 °C at 760 mmHg |
|---|
| Melting Point | -49 °C(lit.) |
|---|
| Molecular Formula | C20H24D8O2 |
|---|
| Molecular Weight | 312.52 |
|---|
| Flash Point | 336.3±18.0 °C |
|---|
| Exact Mass | 312.290436 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 6.91 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.501 |
|---|
| InChIKey | YZXBAPSDXZZRGB-FBFLGLDDSA-N |
|---|
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Supplemental HS | May form explosive peroxides. |
|---|
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|
| Risk Phrases | R11 |
|---|
| Safety Phrases | 16-26-29-33 |
|---|
| RIDADR | UN 1231 3 |
|---|
| WGK Germany | 1 |
|---|
Synonyms
| 5,6,8,9,11,12,14,15-octadeutero-eicostatetraenoic acid |
| Arachidonic Acid-d8 Lipid Maps MS Standard |
| Arachidonic Acid-d8 |
| 5,6,8,9,11,12,14,15-octadeuterated arachidonic acid |
| 5,8,11,14-Eicosatetraenoic-5,6,8,9,11,12,14,15-d acid, (5Z,8Z,11Z,14Z)- |
| Arachidonic acid-5,6,8,9,11,12,14,15-2H8 |
| (5Z,8Z,11Z,14Z)-(5,6,8,9,11,12,14,15-H)-5,8,11,14-Icosatetraenoic acid |
