Introduction：Basic information about CAS 2416-98-0|3-tert-Butylbiphenyl-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-tert-Butylbiphenyl-2-ol |
|---|
| CAS Number | 2416-98-0 | Molecular Weight | 226.314 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 331.4±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 155.4±13.9 °C |
|---|
Names
| Name | 2-tert-butyl-6-phenylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 331.4±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18O |
|---|
| Molecular Weight | 226.314 |
|---|
| Flash Point | 155.4±13.9 °C |
|---|
| Exact Mass | 226.135757 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.63 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | HXVMQDBXJZKLEV-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cccc(-c2ccccc2)c1O |
|---|
Safety Information
Customs
| HS Code | 2907199090 |
|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-Phenyl-6-tert.-butyl-phenol |
| 3-(1,1-Dimethylethyl)(1,1'-biphenyl)-2-ol |
| EINECS 219-331-9 |
| [1,1'-Biphenyl]-2-ol, 3-(1,1-dimethylethyl)- |
| 3-tert-Butylbiphenyl-2-ol |
| 2-Biphenylol,3-tert-butyl |
| 2-Biphenylol, 3-tert-butyl- |
| [1,1'-Biphenyl]-2-ol,3-(1,1-dimethylethyl) |
| 3-(2-Methyl-2-propanyl)-2-biphenylol |
| 2-iso-Butyl-6-phenylphenol |
| 2-tert.-Butyl-6-phenyl-phenol |
