Introduction：Basic information about CAS 231285-88-4|1,5-Dibromo-2-methyl-4-(trifluoromethyl)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,5-Dibromo-2-methyl-4-(trifluoromethyl)benzene |
|---|
| CAS Number | 231285-88-4 | Molecular Weight | 317.928 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 251.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5Br2F3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 105.6±25.9 °C |
|---|
Names
| Name | 1,5-Dibromo-2-methyl-4-(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 251.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5Br2F3 |
|---|
| Molecular Weight | 317.928 |
|---|
| Flash Point | 105.6±25.9 °C |
|---|
| Exact Mass | 315.871002 |
|---|
| LogP | 4.38 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | QQVJNJCYMJBWKB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(F)(F)F)c(Br)cc1Br |
|---|
Synonyms
| Benzene, 1,5-dibromo-2-methyl-4-(trifluoromethyl)- |
| 2,4-Dibromo-5-methylbenzotrifluoride |
| 1,5-Dibromo-2-methyl-4-(trifluoromethyl)benzene |
| 2,4-Dibromo-5-(trifluoromethyl)toluene |
| PC0551 |
