Introduction:Basic information about CAS 2903-34-6|Benzenesulfonamide,N-(4-chlorophenyl)-4-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,N-(4-chlorophenyl)-4-methyl- |
|---|
| CAS Number | 2903-34-6 | Molecular Weight | 281.75800 |
|---|
| Density | 1.362g/cm3 | Boiling Point | 416.7ºC at 760mmHg |
|---|
| Molecular Formula | C13H12ClNO2S | Melting Point | 118-122ºC |
|---|
| MSDS | / | Flash Point | 205.8ºC |
|---|
Names
| Name | N-(4-chlorophenyl)-4-methylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.362g/cm3 |
|---|
| Boiling Point | 416.7ºC at 760mmHg |
|---|
| Melting Point | 118-122ºC |
|---|
| Molecular Formula | C13H12ClNO2S |
|---|
| Molecular Weight | 281.75800 |
|---|
| Flash Point | 205.8ºC |
|---|
| Exact Mass | 281.02800 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 4.60300 |
|---|
| Vapour Pressure | 3.75E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | DOPAQNXFOIXWPI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Benzenesulfonamide,N-(4-chlorophenyl)-4-methyl |
| p-Toluenesulfonanilide,4'-chloro |
| N-Tosyl-p-chloraniline |
| N-(4-chloro-phenyl)-4-methyl-benzenesulfonamide |
| N-(4-chlorophenyl)-p-toluenesulfonamide |
| 4-methyl-N-(4-chlorophenyl)benzenesulfonamide |
| 4-chloro-N-tosylaniline |
| EINECS 220-801-0 |
| N-tosyl-p-chloroaniline |