Introduction：Basic information about CAS 622369-52-2|4-Chloro-7-fluoro-6-hydroxy-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-fluoro-6-hydroxy-3-quinolinecarbonitrile |
|---|
| CAS Number | 622369-52-2 | Molecular Weight | 222.60300 |
|---|
| Density | 1.588g/cm3 | Boiling Point | 381.393ºC at 760 mmHg |
|---|
| Molecular Formula | C10H4ClFN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.46ºC |
|---|
Names
| Name | 4-Chloro-7-fluoro-6-hydroxy-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.588g/cm3 |
|---|
| Boiling Point | 381.393ºC at 760 mmHg |
|---|
| Molecular Formula | C10H4ClFN2O |
|---|
| Molecular Weight | 222.60300 |
|---|
| Flash Point | 184.46ºC |
|---|
| Exact Mass | 222.00000 |
|---|
| PSA | 56.91000 |
|---|
| LogP | 2.60458 |
|---|
| Index of Refraction | 1.683 |
|---|
| InChIKey | HQWUPLKDABZELG-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cnc2cc(F)c(O)cc2c1Cl |
|---|
