Introduction：Basic information about CAS 622369-53-3|4-Chloro-6-ethoxy-7-fluoro-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6-ethoxy-7-fluoro-3-quinolinecarbonitrile |
|---|
| CAS Number | 622369-53-3 | Molecular Weight | 250.65600 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 403.43ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClFN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.788ºC |
|---|
Names
| Name | 4-Chloro-6-ethoxy-7-fluoro-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 403.43ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClFN2O |
|---|
| Molecular Weight | 250.65600 |
|---|
| Flash Point | 197.788ºC |
|---|
| Exact Mass | 250.03100 |
|---|
| PSA | 45.91000 |
|---|
| LogP | 3.29768 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | HOQINUIIFHZUMM-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc2c(Cl)c(C#N)cnc2cc1F |
|---|
