Introduction:Basic information about CAS 622369-65-7|4-Chloro-7-fluoro-6-[2-(4-morpholinyl)ethoxy]-3-quinolinecarbonit rile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-fluoro-6-[2-(4-morpholinyl)ethoxy]-3-quinolinecarbonit rile |
|---|
| CAS Number | 622369-65-7 | Molecular Weight | 335.76100 |
|---|
| Density | 1.397g/cm3 | Boiling Point | 520.761ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15ClFN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.747ºC |
|---|
Names
| Name | 4-Chloro-7-fluoro-6-[2-(4-morpholinyl)ethoxy]-3-quinolinecarbonit rile |
|---|
Chemical & Physical Properties
| Density | 1.397g/cm3 |
|---|
| Boiling Point | 520.761ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15ClFN3O2 |
|---|
| Molecular Weight | 335.76100 |
|---|
| Flash Point | 268.747ºC |
|---|
| Exact Mass | 335.08400 |
|---|
| PSA | 58.38000 |
|---|
| LogP | 2.54788 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | MOVXGKOHTWJWEA-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cnc2cc(F)c(OCCN3CCOCC3)cc2c1Cl |
|---|