Introduction:Basic information about CAS 622369-73-7|4-Chloro-7-(2-methoxyethoxy)-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-(2-methoxyethoxy)-3-quinolinecarbonitrile |
|---|
| CAS Number | 622369-73-7 | Molecular Weight | 262.69200 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 432.989ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.664ºC |
|---|
Names
| Name | 4-Chloro-7-(2-methoxyethoxy)-3-quinolinecarbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 432.989ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClN2O2 |
|---|
| Molecular Weight | 262.69200 |
|---|
| Flash Point | 215.664ºC |
|---|
| Exact Mass | 262.05100 |
|---|
| PSA | 55.14000 |
|---|
| LogP | 2.78508 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | NKNHPOUWDIAROH-UHFFFAOYSA-N |
|---|
| SMILES | COCCOc1ccc2c(Cl)c(C#N)cnc2c1 |
|---|