Introduction：Basic information about CAS 287401-29-0|Benzyl 1-oxo-3-phenyl-2-oxa-5-azaspiro[3.4]octane-5-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl 1-oxo-3-phenyl-2-oxa-5-azaspiro[3.4]octane-5-carboxylate |
|---|
| CAS Number | 287401-29-0 | Molecular Weight | 337.36900 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 528.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 273.4ºC |
|---|
Names
| Name | Benzyl 1-oxo-3-phenyl-2-oxa-5-azaspiro[3.4]octane-5-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 528.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H19NO4 |
|---|
| Molecular Weight | 337.36900 |
|---|
| Flash Point | 273.4ºC |
|---|
| Exact Mass | 337.13100 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 3.39380 |
|---|
| Vapour Pressure | 2.97E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | JWHGTDYLEMAWFE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCc1ccccc1)N1CCCC12C(=O)OC2c1ccccc1 |
|---|
