Introduction:Basic information about CAS 287401-31-4|2-Methyl-2-propanyl 1-oxo-3-phenyl-2-oxa-5-azaspiro[3.4]octane-5- carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-2-propanyl 1-oxo-3-phenyl-2-oxa-5-azaspiro[3.4]octane-5- carboxylate |
|---|
| CAS Number | 287401-31-4 | Molecular Weight | 303.35300 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 447.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.5ºC |
|---|
Names
| Name | 2-Methyl-2-propanyl 1-oxo-3-phenyl-2-oxa-5-azaspiro[3.4]octane-5- carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 447.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO4 |
|---|
| Molecular Weight | 303.35300 |
|---|
| Flash Point | 224.5ºC |
|---|
| Exact Mass | 303.14700 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 2.99210 |
|---|
| Vapour Pressure | 3.3E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | LOCHMDPUTIOJQI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC12C(=O)OC2c1ccccc1 |
|---|