Introduction：Basic information about CAS 101568-40-5|9,9-Dimethyl-1-oxa-7-azaspiro[4.4]nonane-2,6,8-trione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,9-Dimethyl-1-oxa-7-azaspiro[4.4]nonane-2,6,8-trione |
|---|
| CAS Number | 101568-40-5 | Molecular Weight | 197.18800 |
|---|
| Density | / | Boiling Point | 458.7ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231.2ºC |
|---|
Names
| Name | 9,9-Dimethyl-1-oxa-7-azaspiro[4.4]nonane-2,6,8-trione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 458.7ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO4 |
|---|
| Molecular Weight | 197.18800 |
|---|
| Flash Point | 231.2ºC |
|---|
| Exact Mass | 197.06900 |
|---|
| PSA | 75.96000 |
|---|
| LogP | 0.02070 |
|---|
| Vapour Pressure | 1.34E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | TVTRBIFRLIXLAR-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)C(=O)NC(=O)C12CCC(=O)O2 |
|---|
Synonyms
| 9,9-Dimethyl-N-<3-methyl-amino-propyl>-acridan |
| Monometacrinum |
| Desmethyldimetacrine |
| Monometacrina |
| 9,9-Dimethyl-10-<3-methylamino-propyl>-acridan |
| Monometacrine |
