Introduction：Basic information about CAS 1057401-13-4|3,6-bis-(5-Bromo-2-thienyl)-2,5-dihydro-2,5-dioctylpyrrolo[3,4-c]pyrrole-1,4-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-bis-(5-Bromo-2-thienyl)-2,5-dihydro-2,5-dioctylpyrrolo[3,4-c]pyrrole-1,4-dione |
|---|
| CAS Number | 1057401-13-4 | Molecular Weight | 682.573 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 750.6±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H38Br2N2O2S2 | Melting Point | 195ºC |
|---|
| MSDS | / | Flash Point | 407.7±32.9 °C |
|---|
Names
| Name | 3,6-Bis(5-bromothiophen-2-yl)-2,5-dioctylpyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 750.6±60.0 °C at 760 mmHg |
|---|
| Melting Point | 195ºC |
|---|
| Molecular Formula | C30H38Br2N2O2S2 |
|---|
| Molecular Weight | 682.573 |
|---|
| Flash Point | 407.7±32.9 °C |
|---|
| Exact Mass | 680.074158 |
|---|
| PSA | 100.48000 |
|---|
| LogP | 13.17 |
|---|
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | LVCBYFZCUVYBPP-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCN1C(=O)C2=C(c3ccc(Br)s3)N(CCCCCCCC)C(=O)C2=C1c1ccc(Br)s1 |
|---|
Synonyms
| 1,4-bis(5-bromothiophen-2-yl)-2,5-dioctylpyrrolo[3,4-c]pyrrole-3,6-dione |
| 3,6-Bis(5-bromo-2-thienyl)-2,5-dioctyl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione |
| Pyrrolo[3,4-c]pyrrole-1,4-dione, 3,6-bis(5-bromo-2-thienyl)-2,5-dihydro-2,5-dioctyl- |
| 3,6-Bis(5-bromo-2-thienyl)-2,5-di-n-octylpyrrolo[3,4-c]pyrrole-1,4-dione |
