Introduction：Basic information about CAS 107814-37-9|rac-cis-Ambroxol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | rac-cis-Ambroxol |
|---|
| CAS Number | 107814-37-9 | Molecular Weight | 378.103 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 468.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18Br2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.2±28.7 °C |
|---|
Names
| Name | trans-4-[(2-Amino-3,5-dibromobenzyl)amino]cyclohexanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 468.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18Br2N2O |
|---|
| Molecular Weight | 378.103 |
|---|
| Flash Point | 237.2±28.7 °C |
|---|
| Exact Mass | 375.978577 |
|---|
| PSA | 58.28000 |
|---|
| LogP | 2.91 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | JBDGDEWWOUBZPM-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Br)cc(Br)cc1CNC1CCC(O)CC1 |
|---|
Synonyms
| Cyclohexanol, 4-[[(2-amino-3,5-dibromophenyl)methyl]amino]- |
| 4-[(2-Amino-3,5-dibromobenzyl)amino]cyclohexanol |
| Ambroxol Hydrochloride Impurity D |
| 4-[[(2-Amino-3,5-dibromophenyl)methyl]amino]cyclohexanol |
| rac-cis-Ambroxol |
| Ambroxol EP Impurity D |
