Introduction:Basic information about CAS 175135-29-2|3,4,5-TRIBROMO-1-(4-NITROPHENYL)-1H-PYRAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4,5-TRIBROMO-1-(4-NITROPHENYL)-1H-PYRAZOLE |
|---|
| CAS Number | 175135-29-2 | Molecular Weight | 425.85900 |
|---|
| Density | 2.37g/cm3 | Boiling Point | 484.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H4Br3N3O2 | Melting Point | 144ºC |
|---|
| MSDS | / | Flash Point | 246.7ºC |
|---|
Names
| Name | 3,4,5-tribromo-1-(4-nitrophenyl)pyrazole |
|---|
Chemical & Physical Properties
| Density | 2.37g/cm3 |
|---|
| Boiling Point | 484.3ºC at 760mmHg |
|---|
| Melting Point | 144ºC |
|---|
| Molecular Formula | C9H4Br3N3O2 |
|---|
| Molecular Weight | 425.85900 |
|---|
| Flash Point | 246.7ºC |
|---|
| Exact Mass | 422.78500 |
|---|
| PSA | 63.64000 |
|---|
| LogP | 4.59120 |
|---|
| Vapour Pressure | 4.59E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.767 |
|---|
| InChIKey | KYBWIMVHKGHUGS-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(-n2nc(Br)c(Br)c2Br)cc1 |
|---|