Introduction：Basic information about CAS 6660-65-7|4,6-Dichloroisophthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-Dichloroisophthalic acid |
|---|
| CAS Number | 6660-65-7 | Molecular Weight | 235.021 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 437.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4Cl2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.1±28.7 °C |
|---|
Names
| Name | 4,6-dichlorobenzene-1,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 437.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H4Cl2O4 |
|---|
| Molecular Weight | 235.021 |
|---|
| Flash Point | 218.1±28.7 °C |
|---|
| Exact Mass | 233.948669 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.28 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | LJASDYRQBLUXEZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(C(=O)O)c(Cl)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1,3-Benzenedicarboxylic acid,4,6-dichloro |
| 4,6-dichloro-isophthalic acid |
| 4,6-dichloro-1,3-benzenedicarboxylic acid |
| 1,3-Benzenedicarboxylic acid, 4,6-dichloro- |
| 4,6-Dichloroisophthalic acid |
| 4,6-Dichlor-isophthalsaeure |
