Introduction：Basic information about CAS 3212-87-1|(1-Ethyl-3-pyrrolidinyl)(diphenyl)acetonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1-Ethyl-3-pyrrolidinyl)(diphenyl)acetonitrile |
|---|
| CAS Number | 3212-87-1 | Molecular Weight | 290.402 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 417.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H22N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.7±12.4 °C |
|---|
Names
| Name | 2-(1-ethylpyrrolidin-3-yl)-2,2-diphenyl-acetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 417.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H22N2 |
|---|
| Molecular Weight | 290.402 |
|---|
| Flash Point | 173.7±12.4 °C |
|---|
| Exact Mass | 290.178314 |
|---|
| PSA | 27.03000 |
|---|
| LogP | 4.37 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | CLRZIQGKTOQIDR-UHFFFAOYSA-N |
|---|
| SMILES | CCN1CCC(C(C#N)(c2ccccc2)c2ccccc2)C1 |
|---|
Synonyms
| 3-Pyrrolidineacetonitrile, 1-ethyl-α,α-diphenyl- |
| 2-(1-Aethoxy-aethoxy)-2-methyl-propionitril |
| Propanenitrile,2-(1-ethoxyethoxy)-2-methyl |
| 2-(1-ethoxy-ethoxy)-2-methyl-propionitrile |
| (1-Ethyl-3-pyrrolidinyl)(diphenyl)acetonitrile |
| (1-ethyl-pyrrolidin-3-yl)-diphenyl-acetonitrile |
| 3-Pyrrolidine acetonitrile, 1-ethyl-a,a-diphenyl- |
