Introduction：Basic information about CAS 522646-39-5|3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride |
|---|
| CAS Number | 522646-39-5 | Molecular Weight | 222.62800 |
|---|
| Density | 1.335g/cm3 | Boiling Point | 370.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7ClN2O2 | Melting Point | 93ºC |
|---|
| MSDS | / | Flash Point | 177.6ºC |
|---|
Names
| Name | 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.335g/cm3 |
|---|
| Boiling Point | 370.1ºC at 760 mmHg |
|---|
| Melting Point | 93ºC |
|---|
| Molecular Formula | C10H7ClN2O2 |
|---|
| Molecular Weight | 222.62800 |
|---|
| Flash Point | 177.6ºC |
|---|
| Exact Mass | 222.02000 |
|---|
| PSA | 55.99000 |
|---|
| LogP | 2.42400 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | DANOKUDOZKTSKV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2cccc(C(=O)Cl)c2)no1 |
|---|
