Introduction：Basic information about CAS 2455-92-7|Sulclamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sulclamide |
|---|
| CAS Number | 2455-92-7 | Molecular Weight | 234.66000 |
|---|
| Density | 1.574g/cm3 | Boiling Point | 445.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H7ClN2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223.4ºC |
|---|
Names
| Name | 4-Chloro-3-sulfamoylbenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.574g/cm3 |
|---|
| Boiling Point | 445.8ºC at 760mmHg |
|---|
| Molecular Formula | C7H7ClN2O3S |
|---|
| Molecular Weight | 234.66000 |
|---|
| Flash Point | 223.4ºC |
|---|
| Exact Mass | 233.98700 |
|---|
| PSA | 112.62000 |
|---|
| LogP | 2.75160 |
|---|
| Vapour Pressure | 3.84E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | WRLKLPDTRUYBBV-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-Chlor-3-sulfamoyl-benzoesaeure-amid |
| 4-chloro-3-sulfamoyl-benzenecarboxamide |
| 4-Chlor-3-sulfamoylbenzymid |
| 4-chloro-3-sulfamoyl-benzoic acid amide |
| Sulclamide |
| Sulclamida |
| Sulclamidum |
| Sulclamid |
