Introduction：Basic information about CAS 93783-15-4|3,3-dichloro-2-oxoindoline-5-sulphonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3-dichloro-2-oxoindoline-5-sulphonyl chloride |
|---|
| CAS Number | 93783-15-4 | Molecular Weight | 300.54600 |
|---|
| Density | 1.84g/cm3 | Boiling Point | 459.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4Cl3NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231.6ºC |
|---|
Names
| Name | 3,3-dichloro-2-oxo-1H-indole-5-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.84g/cm3 |
|---|
| Boiling Point | 459.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4Cl3NO3S |
|---|
| Molecular Weight | 300.54600 |
|---|
| Flash Point | 231.6ºC |
|---|
| Exact Mass | 298.89800 |
|---|
| PSA | 75.11000 |
|---|
| LogP | 3.36250 |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | XXQVRYBFEWKZBM-UHFFFAOYSA-N |
|---|
| SMILES | O=C1Nc2ccc(S(=O)(=O)Cl)cc2C1(Cl)Cl |
|---|
Safety Information
Customs
| HS Code | 2933790090 |
|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|---|
Synonyms
| 3,3-Dichloro-2-oxoindoline-5-sulphonyl chloride |
| 3,3-Dichlor-2-oxo-indolin-5-sulfonylchlorid |
| 3,3-dichloro-2-oxo-indoline-5-sulfonyl chloride |
| 3,3-dichloro-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride |
| EINECS 298-221-2 |
