Introduction:Basic information about CAS 105907-63-9|3-[(Dimethylamino)methyl]-1H-indole-4-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(Dimethylamino)methyl]-1H-indole-4-carbonitrile |
|---|
| CAS Number | 105907-63-9 | Molecular Weight | 199.25200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H13N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[(Dimethylamino)methyl]-1H-indole-4-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H13N3 |
|---|
| Molecular Weight | 199.25200 |
|---|
| Exact Mass | 199.11100 |
|---|
| PSA | 42.82000 |
|---|
| LogP | 2.10118 |
|---|
| InChIKey | JYFDGWJTTRDEMP-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)Cc1c[nH]c2cccc(C#N)c12 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Dimethylaminomethyl-indol-4-carbonitril |
| 1-(4-cyano-1H-indol-3-yl)-N,N-dimethylmethanamine |
| 1h-indole-2-carboxylic acid,3-[(dimethylamino)methyl]-,ethyl ester |
| Ethyl 3-dimethylaminomethylindole-2-carboxylate |
| 4-Cyano-gramin |
| 3-Dimethylaminomethyl-indol-2-carbonsaeure-aethylester |
| 3-dimethylaminomethyl-indole-4-carbonitrile |
| 3-dimethylaminomethyl-indole-2-carboxylic acid ethyl ester |
| 4-cyano-3-dimethylaminomethylindole |
| ethyl 3-(dimethylaminomethyl)-1H-indole-2-carboxylate |