Introduction:Basic information about CAS 10597-73-6|japothrins, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | japothrins |
|---|
| CAS Number | 10597-73-6 | Molecular Weight | 288.38100 |
|---|
| Density | 1.07g/cm3 | Boiling Point | 348.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H24O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.5ºC |
|---|
Names
| Name | japothrins |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.07g/cm3 |
|---|
| Boiling Point | 348.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H24O3 |
|---|
| Molecular Weight | 288.38100 |
|---|
| Flash Point | 164.5ºC |
|---|
| Exact Mass | 288.17300 |
|---|
| PSA | 39.44000 |
|---|
| LogP | 4.28970 |
|---|
| Vapour Pressure | 5.05E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | QVDCSEPAJNGCBF-UHFFFAOYSA-N |
|---|
| SMILES | C=CCc1ccc(COC(=O)C2C(C=C(C)C)C2(C)C)o1 |
|---|
Synonyms
| 5-allylfurfuryl (±)-cis-trans-chrysanthemate |
| [5-(2-propen-1-yl)-2-furanyl]methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
| 5-allylfurfuryl (1RS)-cis,trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| 5-allylfurfuryl (1RS,3RS |
| [5-(prop-2-en-1-yl)furan-2-yl]methyl (1Ξ,3Ξ)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
| 5-Allylfurfuryl chrysanthemate |
| (5-prop-2-enylfuran-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |