Introduction:Basic information about CAS 17771-33-4|7-HYDROXY-2,2-DIMETHYL-CHROMAN-4-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-HYDROXY-2,2-DIMETHYL-CHROMAN-4-ONE |
|---|
| CAS Number | 17771-33-4 | Molecular Weight | 192.21100 |
|---|
| Density | 1.196g/cm3 | Boiling Point | 354.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.7ºC |
|---|
Names
| Name | 7-hydroxy-2,2-dimethyl-3H-chromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.196g/cm3 |
|---|
| Boiling Point | 354.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O3 |
|---|
| Molecular Weight | 192.21100 |
|---|
| Flash Point | 141.7ºC |
|---|
| Exact Mass | 192.07900 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.13600 |
|---|
| Vapour Pressure | 1.65E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | PHEWNYMTGPOCOP-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)CC(=O)c2ccc(O)cc2O1 |
|---|
Safety Information
Customs
| HS Code | 2914400090 |
|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,2-Dimethyl-7-hydroxychroman-4-one |
| 7-hydroxy-2,2-dimethyl-chroman-4-one |
| 2,3-dihydro-2,2-dimethyl-7-hydroxy-4H-benzopyran-4-one |
| 2,2-dimethylchroman-4-one-7-ol |
| 2,2-dimethyl-7-hydroxy-4-chromanone |
| 7-Hydroxy-2,2-dimethyl-2,3-dihydro-4H-chromen-4-one |
| 7-hydroxy-2,2-dimethyl-2,3-dihydrochromen-4-one |