Introduction：Basic information about CAS 72113-45-2|5-(3-chlorophenyl)-6-(propylamino)pyrazine-2,3-dicarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(3-chlorophenyl)-6-(propylamino)pyrazine-2,3-dicarbonitrile |
|---|
| CAS Number | 72113-45-2 | Molecular Weight | 297.74200 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 509ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12ClN5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 261.6ºC |
|---|
Names
| Name | 5-(3-chlorophenyl)-6-(propylamino)pyrazine-2,3-dicarbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 509ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12ClN5 |
|---|
| Molecular Weight | 297.74200 |
|---|
| Flash Point | 261.6ºC |
|---|
| Exact Mass | 297.07800 |
|---|
| PSA | 85.39000 |
|---|
| LogP | 3.43526 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | PPGJFOXCUVMTRR-UHFFFAOYSA-N |
|---|
| SMILES | CCCNc1nc(C#N)c(C#N)nc1-c1cccc(Cl)c1 |
|---|
Synonyms
| 2,3-dicyano-5-n-propylamino-6-(m-chlorophenyl)pyrazine |
| 2,3-Pyrazinedicarbonitrile,5-(3-chlorophenyl)-6-(propylamino) |
| 5-(3-chloro-phenyl)-6-propylamino-pyrazine-2,3-dicarbonitrile |
