Introduction：Basic information about CAS 73384-69-7|4,8-diamino-2-bromonaphthalene-1,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,8-diamino-2-bromonaphthalene-1,5-dione |
|---|
| CAS Number | 73384-69-7 | Molecular Weight | 267.07900 |
|---|
| Density | 1.85g/cm3 | Boiling Point | 326.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7BrN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 151.3ºC |
|---|
Names
| Name | 4,8-diamino-2-bromonaphthalene-1,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.85g/cm3 |
|---|
| Boiling Point | 326.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7BrN2O2 |
|---|
| Molecular Weight | 267.07900 |
|---|
| Flash Point | 151.3ºC |
|---|
| Exact Mass | 265.96900 |
|---|
| PSA | 86.18000 |
|---|
| LogP | 1.81300 |
|---|
| Index of Refraction | 1.736 |
|---|
| InChIKey | UIZQEEPVXHNUOC-UHFFFAOYSA-N |
|---|
| SMILES | N=C1C=CC(=O)c2c(N)cc(Br)c(O)c21 |
|---|
Synonyms
| 1,5-Naphthalenedione,4,8-diamino-2-bromo |
| 4,8-Diamino-2-bromo-1,5-naphthoquinone |
| EINECS 277-411-9 |
