Introduction：Basic information about CAS 73384-70-0|8-amino-2,3,6-tribromo-5-hydroxy-1,4-naphthoquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-amino-2,3,6-tribromo-5-hydroxy-1,4-naphthoquinone |
|---|
| CAS Number | 73384-70-0 | Molecular Weight | 425.85600 |
|---|
| Density | 2.594g/cm3 | Boiling Point | 526.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H4Br3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.2ºC |
|---|
Names
| Name | 8-amino-2,3,6-tribromo-5-hydroxynaphthalene-1,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.594g/cm3 |
|---|
| Boiling Point | 526.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H4Br3NO3 |
|---|
| Molecular Weight | 425.85600 |
|---|
| Flash Point | 272.2ºC |
|---|
| Exact Mass | 422.77400 |
|---|
| PSA | 80.39000 |
|---|
| LogP | 3.69850 |
|---|
| Index of Refraction | 1.833 |
|---|
| InChIKey | JYQCNZRDPHBDHC-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Br)c(O)c2c1C(=O)C(Br)=C(Br)C2=O |
|---|
Synonyms
| EINECS 277-412-4 |
| 8-Amino-2,3,6-tribromo-5-hydroxy-1,4-naphthoquinone |
| 1,4-Naphthalenedione,8-amino-2,3,6-tribromo-5-hydroxy |
