Introduction:Basic information about CAS 893620-46-7|9-bromo-2-chloro-7-methylpyrido[1,2-a]pyrimidin-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9-bromo-2-chloro-7-methylpyrido[1,2-a]pyrimidin-4-one |
|---|
| CAS Number | 893620-46-7 | Molecular Weight | 273.51400 |
|---|
| Density | 1.77g/cm3 | Boiling Point | 348.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6BrClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.6ºC |
|---|
Names
| Name | 9-bromo-2-chloro-7-methylpyrido[1,2-a]pyrimidin-4-one |
|---|
Chemical & Physical Properties
| Density | 1.77g/cm3 |
|---|
| Boiling Point | 348.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6BrClN2O |
|---|
| Molecular Weight | 273.51400 |
|---|
| Flash Point | 164.6ºC |
|---|
| Exact Mass | 271.93500 |
|---|
| PSA | 34.37000 |
|---|
| LogP | 2.41880 |
|---|
| Index of Refraction | 1.687 |
|---|
| InChIKey | GYHMPEWSQVCIFU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Br)c2nc(Cl)cc(=O)n2c1 |
|---|