Introduction:Basic information about CAS 41113-86-4|N-[4-bromo-2-(trifluoromethyl)phenyl]-3-tert-butyl-2-hydroxy-6-methyl-5-nitrobenzamid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[4-bromo-2-(trifluoromethyl)phenyl]-3-tert-butyl-2-hydroxy-6-methyl-5-nitrobenzamide |
|---|
| CAS Number | 41113-86-4 | Molecular Weight | 475.25600 |
|---|
| Density | 1.527g/cm3 | Boiling Point | 456ºC at 760mmHg |
|---|
| Molecular Formula | C19H18BrF3N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.6ºC |
|---|
Names
| Name | N-[4-bromo-2-(trifluoromethyl)phenyl]-3-tert-butyl-2-hydroxy-6-methyl-5-nitrobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.527g/cm3 |
|---|
| Boiling Point | 456ºC at 760mmHg |
|---|
| Molecular Formula | C19H18BrF3N2O4 |
|---|
| Molecular Weight | 475.25600 |
|---|
| Flash Point | 229.6ºC |
|---|
| Exact Mass | 474.04000 |
|---|
| PSA | 98.64000 |
|---|
| LogP | 6.84710 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | WRPRKPMHLLGGIZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c([N+](=O)[O-])cc(C(C)(C)C)c(O)c1C(=O)Nc1ccc(Br)cc1C(F)(F)F |
|---|
Synonyms
| Bromoxanide (USAN/INN) |
| Bromoxanide |
| Bromoxanidum |
| Bromoxanida |