Introduction:Basic information about CAS 502686-25-1|5-(2-Nitrobenzyl)-4H-1,2,4-triazol-3-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-Nitrobenzyl)-4H-1,2,4-triazol-3-amine |
|---|
| CAS Number | 502686-25-1 | Molecular Weight | 219.20000 |
|---|
| Density | 1.483 | Boiling Point | 512.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9N5O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 263.9ºC |
|---|
Names
| Name | 5-[(2-nitrophenyl)methyl]-1H-1,2,4-triazol-3-amine |
|---|
Chemical & Physical Properties
| Density | 1.483 |
|---|
| Boiling Point | 512.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9N5O2 |
|---|
| Molecular Weight | 219.20000 |
|---|
| Flash Point | 263.9ºC |
|---|
| Exact Mass | 219.07600 |
|---|
| PSA | 114.14000 |
|---|
| LogP | 1.33920 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | MODDVXMNVIWQNS-UHFFFAOYSA-N |
|---|
| SMILES | Nc1n[nH]c(Cc2ccccc2[N+](=O)[O-])n1 |
|---|