Introduction：Basic information about CAS 52136-25-1|2-[[4-[bis(2-hydroxyethyl)amino]phenyl]amino]-5-[(2-hydroxyethyl)amino]cyclohexa-2,5-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[4-[bis(2-hydroxyethyl)amino]phenyl]amino]-5-[(2-hydroxyethyl)amino]cyclohexa-2,5-diene-1,4-dione |
|---|
| CAS Number | 52136-25-1 | Molecular Weight | 361.39200 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 647.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H23N3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 345.4ºC |
|---|
Names
| Name | 2-[4-[bis(2-hydroxyethyl)amino]anilino]-5-(2-hydroxyethylamino)cyclohexa-2,5-diene-1,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 647.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H23N3O5 |
|---|
| Molecular Weight | 361.39200 |
|---|
| Flash Point | 345.4ºC |
|---|
| Exact Mass | 361.16400 |
|---|
| PSA | 122.13000 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | BZYZOJIGZUACMS-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C=C(Nc2ccc(N(CCO)CCO)cc2)C(=O)C=C1NCCO |
|---|
Synonyms
| HC Green no. 1 |
| 2-((4-(Bis(2-hydroxyethyl)amino)phenyl)amino)-5-((2-hydroxyethyl)amino)cyclohexa-2,5-diene-1,4-dione |
| 2-({4-[bis(2-hydroxyethyl)amino]phenyl}amino)-5-[(2-hydroxyethyl)amino]-1,4-benzoquinone |
| HC Green#1 |
