Introduction：Basic information about CAS 52136-46-6|2,4-diisocyanato-1-methylbenzene,oxepan-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-diisocyanato-1-methylbenzene,oxepan-2-one |
|---|
| CAS Number | 52136-46-6 | Molecular Weight | 288.29900 |
|---|
| Density | / | Boiling Point | 251ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.5ºC |
|---|
Names
| Name | 2,4-diisocyanato-1-methylbenzene,oxepan-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 251ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N2O4 |
|---|
| Molecular Weight | 288.29900 |
|---|
| Flash Point | 110.5ºC |
|---|
| Exact Mass | 288.11100 |
|---|
| PSA | 85.16000 |
|---|
| LogP | 3.03320 |
|---|
| InChIKey | MAOBUYYIFOUQQI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.O=C1CCCCCO1 |
|---|
Synonyms
| Polycaprolactone,2,4-toluenediisocyanate polymer |
| 2-Oxepanone,polymer with 2,4-diisocyanato-1-methylbenzene |
