Introduction:Basic information about CAS 62554-14-7|Dihydro-1-((4-butoxyphenyl)methyl)-5-methyl-2,4(1H,3H)-pyrimidinedione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dihydro-1-((4-butoxyphenyl)methyl)-5-methyl-2,4(1H,3H)-pyrimidinedione |
|---|
| CAS Number | 62554-14-7 | Molecular Weight | 290.35700 |
|---|
| Density | 1.123g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H22N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-[(4-butoxyphenyl)methyl]-5-methyl-1,3-diazinane-2,4-dione |
|---|
Chemical & Physical Properties
| Density | 1.123g/cm3 |
|---|
| Molecular Formula | C16H22N2O3 |
|---|
| Molecular Weight | 290.35700 |
|---|
| Exact Mass | 290.16300 |
|---|
| PSA | 62.13000 |
|---|
| LogP | 2.76720 |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | QLFAROJQYKCGDY-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(CN2CC(C)C(=O)NC2=O)cc1 |
|---|