Introduction：Basic information about CAS 52793-11-0|Acetoacetic-4-chloro-o-anisidide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetoacetic-4-chloro-o-anisidide |
|---|
| CAS Number | 52793-11-0 | Molecular Weight | 241.67100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H12ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | acetoacetic acid-(5-chloro-2-methoxy-anilide) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H12ClNO3 |
|---|
| Molecular Weight | 241.67100 |
|---|
| Exact Mass | 241.05100 |
|---|
| PSA | 58.89000 |
|---|
| LogP | 2.91570 |
|---|
| InChIKey | HSGGSKCDDPPKMD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cl)cc1NC(=O)CC(C)=O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Butanamide,N-(4-methyl-2-nitrophenyl)-3-oxo |
| Acetoacet-4-methyl-2-nitroanilid |
| N-(5-Chloro-2-methoxyphenyl)-3-oxobutanamide |
| 2-Methoxy-5-chlor-acetoacetanilid |
| Acetessigsaeure-(4-methyl-2-nitro-anilid) |
| 5'-chloro-2'-methoxyacetoacetanilide |
| Acetessigsaeure-(5-chlor-2-methoxy-anilid) |
| Acetessigsaeure-(2-nitro-4-methyl-anilid) |
| 4'-Methyl-2'-nitro-acetoacetanilid |
| acetoacetic acid-(4-methyl-2-nitro-anilide) |
