Introduction：Basic information about CAS 81-42-5|1,4-Diamino-2,3-dichloro-9,10-anthraquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Diamino-2,3-dichloro-9,10-anthraquinone |
|---|
| CAS Number | 81-42-5 | Molecular Weight | 307.132 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 601.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8Cl2N2O2 | Melting Point | 295°C |
|---|
| MSDS | / | Flash Point | 317.5±31.5 °C |
|---|
Names
| Name | Disperse Violet 28 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 601.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 295°C |
|---|
| Molecular Formula | C14H8Cl2N2O2 |
|---|
| Molecular Weight | 307.132 |
|---|
| Flash Point | 317.5±31.5 °C |
|---|
| Exact Mass | 305.996277 |
|---|
| PSA | 86.18000 |
|---|
| LogP | 5.62 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.757 |
|---|
| InChIKey | KZYAYVSWIPZDKL-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Cl)c(Cl)c(N)c2c1C(=O)c1ccccc1C2=O |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
Synonyms
| 1,4-Diamino-2,3-dichloro-9,10-anthraquinone |
| EINECS 201-348-8 |
| DCDA |
| 1,4-diamino-2,3-dichloro-anthraquinone |
| MFCD00035693 |
| Violet 2RE. |
| Solvent Violet 51 |
| 9,10-Anthracenedione, 1,4-diamino-2,3-dichloro- |
| Dicyaniamide |
| 2,3-dichloro-1,4-diaminoanthraquinone |
| 1,4-diamino-2,3-dichloro-9,10-anthracenedione |
| Arlisil Violet R2 |
| 1,4-diamino-2,3-dichloroanthracene-9,10-dione |
| LATYL VIOLET 2R |
| 1,4-Diamino-2,3-dichloro anthraquinone (DCDA) |
| 1,4-Diamino-2,3-dichlor-anthrachinon |
| solvent violet 31 |
| Resolin Violet RL |
