Introduction：Basic information about CAS 69777-74-8|[S-(R*,R*)]-4-(2-methylbutyl)phenyl 4-(2-methylbutyl)[1,1'-biphenyl]-4-carboxylat, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [S-(R*,R*)]-4-(2-methylbutyl)phenyl 4-(2-methylbutyl)[1,1'-biphenyl]-4-carboxylate |
|---|
| CAS Number | 69777-74-8 | Molecular Weight | 414.57900 |
|---|
| Density | 1.027g/cm3 | Boiling Point | 539.3ºC at 760 mmHg |
|---|
| Molecular Formula | C29H34O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.8ºC |
|---|
Names
| Name | [S-(R*,R*)]-4-(2-methylbutyl)phenyl 4-(2-methylbutyl)[1,1'-biphenyl]-4-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.027g/cm3 |
|---|
| Boiling Point | 539.3ºC at 760 mmHg |
|---|
| Molecular Formula | C29H34O2 |
|---|
| Molecular Weight | 414.57900 |
|---|
| Flash Point | 227.8ºC |
|---|
| Exact Mass | 414.25600 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 7.81210 |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | RHUXKIANICSJAI-VXKWHMMOSA-N |
|---|
| SMILES | CCC(C)Cc1ccc(OC(=O)c2ccc(-c3ccc(CC(C)CC)cc3)cc2)cc1 |
|---|
