Introduction：Basic information about CAS 107819-90-9|N,N′-Di-Boc-S-methylisothiourea, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N′-Di-Boc-S-methylisothiourea |
|---|
| CAS Number | 107819-90-9 | Molecular Weight | 290.379 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H22N2O4S | Melting Point | 115-121ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,3-Bis(tert-butoxycarbonyl)-2-methyl-2-thiopseudourea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Melting Point | 115-121ºC(lit.) |
|---|
| Molecular Formula | C12H22N2O4S |
|---|
| Molecular Weight | 290.379 |
|---|
| Exact Mass | 290.130035 |
|---|
| PSA | 102.29000 |
|---|
| LogP | 3.48 |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | UQJXXWHAJKRDKY-UHFFFAOYSA-N |
|---|
| SMILES | CSC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | 24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Methyl N,N'-Bis(tert-butoxycarbonyl)carbamimidothioate |
| Carbamic acid, N,N'-[(methylthio)methylidyne]bis-, bis(1,1-dimethylethyl) ester |
| Carbamic acid, N,N'-[(Z)-(methylthio)methylidyne]bis-, bis(1,1-dimethylethyl) ester |
| N,N'-Bis(tert-butoxycarbonyl)-S-methylisothiourea |
| tert-Butyl N-[[(tert-butoxycarbonyl)amino](methylthio)methylene]carbamate |
| 1,3-Di-BOC-2-methylisothiourea |
| MFCD00239356 |
| 1,3-Bis(tert-butoxycarbonyl)-2-methyl-2-thiopseudourea |
| 1,3-Bis-(tert-butoxycarbonyl)-2-methyl-thiopseudourea |
| Di-tert-butyl [(methylsulfanyl)methylylidene]biscarbamate |
| N,N'-Di-Boc-carbamimidothioic Acid Methyl Ester |
| Methyl N,N'-Di-Boc-carbamimidothioate |
| N,N′-Di-Boc-S-methylisothiourea |
| Bis(2-methyl-2-propanyl) [(Z)-(methylsulfanyl)methylylidene]biscarbamate |
| N,N'-Bis(tert-butoxycarbonyl)carbamimidothioic Acid Methyl Ester |
| N,N'-Di-Boc-S-methylisothiourea |
