Introduction：Basic information about CAS 101537-64-8|Boc-3-Aminothiophene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-3-Aminothiophene-2-carboxylic acid |
|---|
| CAS Number | 101537-64-8 | Molecular Weight | 243.28000 |
|---|
| Density | 1.348g/cm3 | Boiling Point | 334.2ºC at 760mmHg |
|---|
| Molecular Formula | C10H13NO4S | Melting Point | 168ºC |
|---|
| MSDS | USA | Flash Point | 155.9ºC |
|---|
Names
| Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.348g/cm3 |
|---|
| Boiling Point | 334.2ºC at 760mmHg |
|---|
| Melting Point | 168ºC |
|---|
| Molecular Formula | C10H13NO4S |
|---|
| Molecular Weight | 243.28000 |
|---|
| Flash Point | 155.9ºC |
|---|
| Exact Mass | 243.05700 |
|---|
| PSA | 103.87000 |
|---|
| LogP | 2.86630 |
|---|
| Vapour Pressure | 5.14E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | QAXIGPOUDYLWDU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)Nc1ccsc1C(=O)O |
|---|
Safety Information
| Safety Phrases | 22-24/25 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Thiophenecarboxylicacid,3-[[(1,1-dimethylethoxy)carbonyl]amino] |
| 3-N-Boc-amino-thiophene-2-carboxylicacid |
| 3-[(tert-butoxy)carbonylamino]-2-thiophenecarboxylic acid |
| boc-3-amino-thiophene-2-carboxylic acid |
| 3-t-Butoxycarbonylaminothiophene-2-carboxylic acid |
| 3-[(tert-butoxycarbonyl)amino]thiophene-2-carboxylic acid |
