Introduction:Basic information about CAS 6952-34-7|2-(4-hydroxyphenyl)quinoline-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-hydroxyphenyl)quinoline-4-carboxylic acid |
|---|
| CAS Number | 6952-34-7 | Molecular Weight | 265.26300 |
|---|
| Density | 1.374g/cm3 | Boiling Point | 500.997ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.794ºC |
|---|
Names
| Name | 2-(4-oxocyclohexa-2,5-dien-1-ylidene)-1H-quinoline-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.374g/cm3 |
|---|
| Boiling Point | 500.997ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11NO3 |
|---|
| Molecular Weight | 265.26300 |
|---|
| Flash Point | 256.794ºC |
|---|
| Exact Mass | 265.07400 |
|---|
| PSA | 70.42000 |
|---|
| LogP | 3.30560 |
|---|
| Index of Refraction | 1.712 |
|---|
| InChIKey | KXZJHVJKXJLBKO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(-c2ccc(O)cc2)nc2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| cinchoninsaeure |
| 2-(4-Hydroxy-phenyl)-quinoline-4-carboxylic acid |
| 2-<4-Hydroxy-phenyl>-4-carboxy-chinolin |
| MFCD00687527 |
| 4-Carboxy-2-<4-hydroxy-phenyl>chinolin |
| 2-(4-Hydroxy-phenyl)-chinolin-4-carbonsaeure |
| 2-(2-METHYLVALERYL)OXAZOLE |