Introduction:Basic information about CAS 320-32-1|4-Hydroxy-2-(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Hydroxy-2-(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 320-32-1 | Molecular Weight | 206.119 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 322.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5F3O3 | Melting Point | 159-161°C |
|---|
| MSDS | USA | Flash Point | 148.9±27.9 °C |
|---|
Names
| Name | 4-hydroxy-2-(trifluoromethyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 322.6±42.0 °C at 760 mmHg |
|---|
| Melting Point | 159-161°C |
|---|
| Molecular Formula | C8H5F3O3 |
|---|
| Molecular Weight | 206.119 |
|---|
| Flash Point | 148.9±27.9 °C |
|---|
| Exact Mass | 206.019073 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 3.29 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.510 |
|---|
| InChIKey | CSQAVQLFCBRQJM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(O)cc1C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36-51 |
|---|
| Safety Phrases | 26 |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD01091007 |
| 4-Hydroxy-2-(trifluoromethyl)benzoic acid |
| 2-Carboxy-5-hydroxybenzotrifluoride |
| 2-trifluoromethyl-4-hydroxybenzoic acid |
| α,α,α-Trifluoro-4-hydroxy-o-toluic acid |
| 4-Hydroxy-2-trifluormethyl-benzoesaeure |
| Benzoic acid, 4-hydroxy-2-(trifluoromethyl)- |
| QVR DQ BXFFF |
| 4-hydroxy-2-trifluoromethyl-benzoic acid |