Introduction：Basic information about CAS 27593-40-4|3-Phenylglycidic acid tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Phenylglycidic acid tert-butyl ester |
|---|
| CAS Number | 27593-40-4 | Molecular Weight | 220.26400 |
|---|
| Density | 1.125 | Boiling Point | 291ºC |
|---|
| Molecular Formula | C13H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118ºC |
|---|
Names
| Name | 3-Phenylglycidic acid tert-butyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.125 |
|---|
| Boiling Point | 291ºC |
|---|
| Molecular Formula | C13H16O3 |
|---|
| Molecular Weight | 220.26400 |
|---|
| Flash Point | 118ºC |
|---|
| Exact Mass | 220.11000 |
|---|
| PSA | 38.83000 |
|---|
| LogP | 2.46820 |
|---|
| Vapour Pressure | 0.00197mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | LKKOTPSFKLPCQF-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)C1OC1c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| tert-Butyl 3-phenylglycidate |
| (2R,3S)-t-butyl 2,3-epoxy-3-phenylpropanoate |
| 3-phenyl-oxiranecarboxylic acid tert-butyl ester |
| (E/Z)-t-butyl 3-phenylglycidate |
| 3-Phenyloxiranecarboxylic acid 1,1-dimethylethyl ester |
| tert-butyl 3-phenyloxirane-2-carboxylate |
