Introduction:Basic information about CAS 6946-15-2|3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID |
|---|
| CAS Number | 6946-15-2 | Molecular Weight | 197.14500 |
|---|
| Density | 1.534g/cm3 | Boiling Point | 379.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 | Melting Point | 185-187ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 171.1ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-hydroxy-4-methyl-2-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.534g/cm3 |
|---|
| Boiling Point | 379.7ºC at 760 mmHg |
|---|
| Melting Point | 185-187ºC(lit.) |
|---|
| Molecular Formula | C8H7NO5 |
|---|
| Molecular Weight | 197.14500 |
|---|
| Flash Point | 171.1ºC |
|---|
| Exact Mass | 197.03200 |
|---|
| PSA | 103.35000 |
|---|
| LogP | 1.83020 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | HEKGHQKEERXLOI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)O)c([N+](=O)[O-])c1O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S37-S39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00007106 |
| 3-Hydroxy-4-methyl-2-nitro-benzoic acid |
| 3-Hydroxy-4-methyl-2-nitro-benzoesaeure |
| 4-Methyl-3-hydroxy-2-nitrobenzoic acid |
| 2-nitro-3-hydroxy-4-methylbenzoic acid |
| 3-hydroxy-2-nitro-p-toluic acid |
| EINECS 230-105-9 |