Introduction：Basic information about CAS 52331-30-3|4-Aminophenylphosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Aminophenylphosphate |
|---|
| CAS Number | 52331-30-3 | Molecular Weight | 211.08800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H7NNaO4P | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-phosphonatoaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H7NNaO4P |
|---|
| Molecular Weight | 211.08800 |
|---|
| Exact Mass | 211.00100 |
|---|
| PSA | 105.42000 |
|---|
| LogP | 1.75970 |
|---|
| InChIKey | OAOBMEMWHJWPNA-UHFFFAOYSA-L |
|---|
| SMILES | Nc1ccc(P(=O)([O-])[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2922199090 |
|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| p-Aminophenyl phosphate |
| Phenol,4-amino-,dihydrogen phosphate (ester) (9CI) |
| phosphoric acid mono-(4-amino-phenyl ester) |
| para-aminophenyl phosphoric acid |
| Phosphorsaeure-mono-(4-amino-phenylester) |
| p-Anilinphosphat |
| Phenol,4-amino-,1-(dihydrogen phosphate) |
| Phenol,p-amino-,phosphate(7CI) |
| p-Aminophenyl dihydrogen phosphate |
| p-Amino-phenol-monophosphat |
| 4-Aminophenyl dihydrogen phosphate |
| 4-AMINOPHENYLPHOSPHONATE |
| 4-Aminophenyl phosphate |
