Introduction:Basic information about CAS 6979-94-8|2',3',5'-Triacetylguanosine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2',3',5'-Triacetylguanosine |
|---|
| CAS Number | 6979-94-8 | Molecular Weight | 409.351 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 655.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19N5O8 | Melting Point | 226-231 °C(lit.) |
|---|
| MSDS | / | Flash Point | 350.4ºC |
|---|
Names
| Name | 2',3',5'-Tri-O-acetylguanosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 655.8ºC at 760 mmHg |
|---|
| Melting Point | 226-231 °C(lit.) |
|---|
| Molecular Formula | C16H19N5O8 |
|---|
| Molecular Weight | 409.351 |
|---|
| Flash Point | 350.4ºC |
|---|
| Exact Mass | 409.123352 |
|---|
| PSA | 177.72000 |
|---|
| LogP | 0.69 |
|---|
| Index of Refraction | 1.698 |
|---|
| InChIKey | ULXDFYDZZFYGIY-SDBHATRESA-N |
|---|
| SMILES | CC(=O)OCC1OC(n2cnc3c(=O)[nH]c(N)nc32)C(OC(C)=O)C1OC(C)=O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Guanosine, 2',3',5'-triacetate |
| Acetic acid (2R,3R,4R,5R)-3,4-diace; toxy-5-(2-amino-6-oxo-1,6-dihydro-p; urin-9-yl)-tetrahydro-furan-2-ylmet; hyl ester |
| EINECS 230-242-4 |
| [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl acetate |
| MFCD00057054 |
| 2',3',5'-Triacetylguanosine |
| 2',3',5'-Tri-O-acetylguanosine |